C26H25ClF2N6O — CID 163374902
4-[[(1R,3S)-3-aminocyclopentyl]amino]-N'-(2-chlorophenyl)-6-[3-(difluoromethoxy)phenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163374902) has the molecular formula C26H25ClF2N6O and a molecular weight of 510.98 g/mol. Its IUPAC name is 4-[[(1R,3S)-3-aminocyclopentyl]amino]-N'-(2-chlorophenyl)-6-[3-(difluoromethoxy)phenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 4-[[(1R,3S)-3-aminocyclopentyl]amino]-N'-(2-chlorophenyl)-6-[3-(difluoromethoxy)phenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163374902 |
| Molecular Formula | C26H25ClF2N6O |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 4-[[(1R,3S)-3-aminocyclopentyl]amino]-N'-(2-chlorophenyl)-6-[3-(difluoromethoxy)phenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | N/C(=N\c1ccccc1Cl)c1cnn2cc(-c3cccc(OC(F)F)c3)cc2c1N[C@@H]1CC[C@H](N)C1 |
| InChI | InChI=1S/C26H25ClF2N6O/c27-21-6-1-2-7-22(21)34-25(31)20-13-32-35-14-16(15-4-3-5-19(10-15)36-26(28)29)11-23(35)24(20)33-18-9-8-17(30)12-18/h1-7,10-11,13-14,17-18,26,33H,8-9,12,30H2,(H2,31,34)/t17-,18+/m0/s1 |
| InChIKey | GXYDODFWYUOCJO-ZWKOTPCHSA-N |
| XLogP | 5.58 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|