C31H35ClFN7O2 — CID 163374921
N-[2-[4-[4-[(4-aminocyclohexyl)amino]-3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-6-yl]-3-methylphenoxy]ethyl]acetamide (PubChem CID 163374921) has the molecular formula C31H35ClFN7O2 and a molecular weight of 592.12 g/mol. Its IUPAC name is N-[2-[4-[4-[(4-aminocyclohexyl)amino]-3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-6-yl]-3-methylphenoxy]ethyl]acetamide.
| Compound Name | N-[2-[4-[4-[(4-aminocyclohexyl)amino]-3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-6-yl]-3-methylphenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 163374921 |
| Molecular Formula | C31H35ClFN7O2 |
| Molecular Weight | 592.12 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | N-[2-[4-[4-[(4-aminocyclohexyl)amino]-3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-6-yl]-3-methylphenoxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOc1ccc(-c2cc3c(NC4CCC(N)CC4)c(/C(N)=N/c4cc(F)ccc4Cl)cnn3c2)c(C)c1 |
| InChI | InChI=1S/C31H35ClFN7O2/c1-18-13-24(42-12-11-36-19(2)41)8-9-25(18)20-14-29-30(38-23-6-4-22(34)5-7-23)26(16-37-40(29)17-20)31(35)39-28-15-21(33)3-10-27(28)32/h3,8-10,13-17,22-23,38H,4-7,11-12,34H2,1-2H3,(H2,35,39)(H,36,41) |
| InChIKey | JURCMXSLHVHRIT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.12 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|