About 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine
1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine (PubChem CID 163374943) has the molecular formula C13H20BrN3
and a molecular weight of 298.23 g/mol. Its IUPAC name is 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine.
Molecular Properties
| Compound Name | 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine |
| PubChem CID | 163374943 |
| Molecular Formula | C13H20BrN3 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine |
| SMILES | CN(C)C1CCCN(c2ccncc2Br)CC1 |
| InChI | InChI=1S/C13H20BrN3/c1-16(2)11-4-3-8-17(9-6-11)13-5-7-15-10-12(13)14/h5,7,10-11H,3-4,6,8-9H2,1-2H3 |
| InChIKey | KENIYHGUSSZBJI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine?
The IUPAC name of 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine (CID 163374943) is 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine.
What is the SMILES notation for 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine?
The canonical SMILES for 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine is CN(C)C1CCCN(c2ccncc2Br)CC1.
What is the InChIKey of 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine?
The InChIKey is KENIYHGUSSZBJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20BrN3/c1-16(2)11-4-3-8-17(9-6-11)13-5-7-15-10-12(13)14/h5,7,10-11H,3-4,6,8-9H2,1-2H3.
What are the key properties of 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine?
1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine has a molecular weight of 298.23 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromo-4-pyridinyl)-N,N-dimethylazepan-4-amine is sourced from PubChem (CID 163374943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).