C30H33ClFN7O3 — CID 163374963
N'-(2-chloro-5-fluorophenyl)-4-[[(1R)-3-iminocyclopentyl]amino]-6-[6-[2-(2-methoxyethoxy)ethoxy]-4-methyl-3-pyridinyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163374963) has the molecular formula C30H33ClFN7O3 and a molecular weight of 594.09 g/mol. Its IUPAC name is N'-(2-chloro-5-fluorophenyl)-4-[[(1R)-3-iminocyclopentyl]amino]-6-[6-[2-(2-methoxyethoxy)ethoxy]-4-methyl-3-pyridinyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-chloro-5-fluorophenyl)-4-[[(1R)-3-iminocyclopentyl]amino]-6-[6-[2-(2-methoxyethoxy)ethoxy]-4-methyl-3-pyridinyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163374963 |
| Molecular Formula | C30H33ClFN7O3 |
| Molecular Weight | 594.09 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | N'-(2-chloro-5-fluorophenyl)-4-[[(1R)-3-iminocyclopentyl]amino]-6-[6-[2-(2-methoxyethoxy)ethoxy]-4-methyl-3-pyridinyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | [H]/N=C1/CC[C@@H](Nc2c(/C(N)=N/c3cc(F)ccc3Cl)cnn3cc(-c4cnc(OCCOCCOC)cc4C)cc23)C1 |
| InChI | InChI=1S/C30H33ClFN7O3/c1-18-11-28(42-10-9-41-8-7-40-2)35-15-23(18)19-12-27-29(37-22-5-4-21(33)14-22)24(16-36-39(27)17-19)30(34)38-26-13-20(32)3-6-25(26)31/h3,6,11-13,15-17,22,33,37H,4-5,7-10,14H2,1-2H3,(H2,34,38)/b33-21-/t22-/m1/s1 |
| InChIKey | CTLRSPLCUFTOAI-VOYCZCILSA-N |
| XLogP | 5.56 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.09 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|