C22H25BrClF3N4OSi — CID 163374968
6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)phenyl]-4-chloropyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163374968) has the molecular formula C22H25BrClF3N4OSi and a molecular weight of 561.91 g/mol. Its IUPAC name is 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)phenyl]-4-chloropyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)phenyl]-4-chloropyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163374968 |
| Molecular Formula | C22H25BrClF3N4OSi |
| Molecular Weight | 561.91 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)phenyl]-4-chloropyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(/N=C(\N)c2cnn3cc(Br)cc3c2Cl)c(CC(F)(F)F)c1 |
| InChI | InChI=1S/C22H25BrClF3N4OSi/c1-21(2,3)33(4,5)32-15-6-7-17(13(8-15)10-22(25,26)27)30-20(28)16-11-29-31-12-14(23)9-18(31)19(16)24/h6-9,11-12H,10H2,1-5H3,(H2,28,30) |
| InChIKey | TYAQTMQFQWYSFH-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 64.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.91 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|