C26H27FN6O2 — CID 163375077
N'-(2-ethyl-4-hydroxyphenyl)-6-(2-fluoro-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375077) has the molecular formula C26H27FN6O2 and a molecular weight of 474.54 g/mol. Its IUPAC name is N'-(2-ethyl-4-hydroxyphenyl)-6-(2-fluoro-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-ethyl-4-hydroxyphenyl)-6-(2-fluoro-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375077 |
| Molecular Formula | C26H27FN6O2 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | N'-(2-ethyl-4-hydroxyphenyl)-6-(2-fluoro-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O)ccc1/N=C(\N)c1cnn2cc(-c3ccc(C)nc3F)cc2c1N[C@H]1CCOC1 |
| InChI | InChI=1S/C26H27FN6O2/c1-3-16-10-19(34)5-7-22(16)32-26(28)21-12-29-33-13-17(20-6-4-15(2)30-25(20)27)11-23(33)24(21)31-18-8-9-35-14-18/h4-7,10-13,18,31,34H,3,8-9,14H2,1-2H3,(H2,28,32)/t18-/m0/s1 |
| InChIKey | SJGRXINBERXUSA-SFHVURJKSA-N |
| XLogP | 4.35 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|