C26H28FN7O — CID 163375129
N'-(2-ethyl-4-hydroxyphenyl)-6-(2-fluoro-3-pyridinyl)-4-[[(2R)-pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375129) has the molecular formula C26H28FN7O and a molecular weight of 473.56 g/mol. Its IUPAC name is N'-(2-ethyl-4-hydroxyphenyl)-6-(2-fluoro-3-pyridinyl)-4-[[(2R)-pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-ethyl-4-hydroxyphenyl)-6-(2-fluoro-3-pyridinyl)-4-[[(2R)-pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375129 |
| Molecular Formula | C26H28FN7O |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | N'-(2-ethyl-4-hydroxyphenyl)-6-(2-fluoro-3-pyridinyl)-4-[[(2R)-pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O)ccc1/N=C(\N)c1cnn2cc(-c3cccnc3F)cc2c1NC[C@H]1CCCN1 |
| InChI | InChI=1S/C26H28FN7O/c1-2-16-11-19(35)7-8-22(16)33-26(28)21-14-32-34-15-17(20-6-4-10-30-25(20)27)12-23(34)24(21)31-13-18-5-3-9-29-18/h4,6-8,10-12,14-15,18,29,31,35H,2-3,5,9,13H2,1H3,(H2,28,33)/t18-/m1/s1 |
| InChIKey | HRRMFHCGIXNVJA-GOSISDBHSA-N |
| XLogP | 4.00 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|