C26H29BrFN5O2 — CID 163375275
6-bromo-N'-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[(5-hydroxy-2-adamantyl)amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375275) has the molecular formula C26H29BrFN5O2 and a molecular weight of 542.45 g/mol. Its IUPAC name is 6-bromo-N'-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[(5-hydroxy-2-adamantyl)amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 6-bromo-N'-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[(5-hydroxy-2-adamantyl)amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375275 |
| Molecular Formula | C26H29BrFN5O2 |
| Molecular Weight | 542.45 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 6-bromo-N'-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[(5-hydroxy-2-adamantyl)amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O)c(F)cc1/N=C(/N)c1cnn2cc(Br)cc2c1NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C26H29BrFN5O2/c1-2-14-5-22(34)19(28)7-20(14)31-25(29)18-11-30-33-12-17(27)6-21(33)24(18)32-23-15-3-13-4-16(23)10-26(35,8-13)9-15/h5-7,11-13,15-16,23,32,34-35H,2-4,8-10H2,1H3,(H2,29,31) |
| InChIKey | DTSWGBJUHIKQQV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 108.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|