C35H44ClN5O4Si — CID 163375345
ethyl 2-[4-[3-[N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]carbamimidoyl]-4-(cyclopentylamino)pyrrolo[1,2-b]pyridazin-6-yl]phenoxy]acetate (PubChem CID 163375345) has the molecular formula C35H44ClN5O4Si and a molecular weight of 662.31 g/mol. Its IUPAC name is ethyl 2-[4-[3-[N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]carbamimidoyl]-4-(cyclopentylamino)pyrrolo[1,2-b]pyridazin-6-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[3-[N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]carbamimidoyl]-4-(cyclopentylamino)pyrrolo[1,2-b]pyridazin-6-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 163375345 |
| Molecular Formula | C35H44ClN5O4Si |
| Molecular Weight | 662.31 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | ethyl 2-[4-[3-[N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-chlorophenyl]carbamimidoyl]-4-(cyclopentylamino)pyrrolo[1,2-b]pyridazin-6-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(-c2cc3c(NC4CCCC4)c(/C(N)=N/c4ccc(O[Si](C)(C)C(C)(C)C)cc4Cl)cnn3c2)cc1 |
| InChI | InChI=1S/C35H44ClN5O4Si/c1-7-43-32(42)22-44-26-14-12-23(13-15-26)24-18-31-33(39-25-10-8-9-11-25)28(20-38-41(31)21-24)34(37)40-30-17-16-27(19-29(30)36)45-46(5,6)35(2,3)4/h12-21,25,39H,7-11,22H2,1-6H3,(H2,37,40) |
| InChIKey | KGCUXHUAOYFSRK-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.31 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|