C32H36N10 — CID 163375365
4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-(1-methylpyrazol-4-yl)-N'-(4-phenyldiazenylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375365) has the molecular formula C32H36N10 and a molecular weight of 560.71 g/mol. Its IUPAC name is 4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-(1-methylpyrazol-4-yl)-N'-(4-phenyldiazenylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-(1-methylpyrazol-4-yl)-N'-(4-phenyldiazenylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375365 |
| Molecular Formula | C32H36N10 |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | 4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-(1-methylpyrazol-4-yl)-N'-(4-phenyldiazenylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | Cn1cc(-c2cc3c(N[C@@H]4CC[C@](C)(N)C4(C)C)c(/C(N)=N/c4ccc(/N=N/c5ccccc5)cc4)cnn3c2)cn1 |
| InChI | InChI=1S/C32H36N10/c1-31(2)28(14-15-32(31,3)34)38-29-26(18-36-42-20-21(16-27(29)42)22-17-35-41(4)19-22)30(33)37-23-10-12-25(13-11-23)40-39-24-8-6-5-7-9-24/h5-13,16-20,28,38H,14-15,34H2,1-4H3,(H2,33,37)/b40-39+/t28-,32+/m1/s1 |
| InChIKey | BFEXBRFFQMBUDS-DRMILPOGSA-N |
| XLogP | 6.51 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|