C29H30F3N5O — CID 163375609
N'-(2-ethyl-4-hydroxyphenyl)-6-phenyl-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375609) has the molecular formula C29H30F3N5O and a molecular weight of 521.59 g/mol. Its IUPAC name is N'-(2-ethyl-4-hydroxyphenyl)-6-phenyl-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-ethyl-4-hydroxyphenyl)-6-phenyl-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375609 |
| Molecular Formula | C29H30F3N5O |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | N'-(2-ethyl-4-hydroxyphenyl)-6-phenyl-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O)ccc1/N=C(\N)c1cnn2cc(-c3ccccc3)cc2c1NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C29H30F3N5O/c1-2-18-14-21(38)12-13-24(18)36-28(33)22-16-34-37-17-20(19-8-4-3-5-9-19)15-26(37)27(22)35-25-11-7-6-10-23(25)29(30,31)32/h3-5,8-9,12-17,23,25,35,38H,2,6-7,10-11H2,1H3,(H2,33,36) |
| InChIKey | XEOQMQHWGXUGOE-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|