C28H29F2N5O3 — CID 163375693
N',6-bis(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375693) has the molecular formula C28H29F2N5O3 and a molecular weight of 521.57 g/mol. Its IUPAC name is N',6-bis(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N',6-bis(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375693 |
| Molecular Formula | C28H29F2N5O3 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | N',6-bis(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O)c(F)cc1/N=C(\N)c1cnn2cc(-c3cc(F)c(O)cc3CC)cc2c1N[C@H]1CCOC1 |
| InChI | InChI=1S/C28H29F2N5O3/c1-3-15-8-25(36)21(29)10-19(15)17-7-24-27(33-18-5-6-38-14-18)20(12-32-35(24)13-17)28(31)34-23-11-22(30)26(37)9-16(23)4-2/h7-13,18,33,36-37H,3-6,14H2,1-2H3,(H2,31,34)/t18-/m0/s1 |
| InChIKey | XVYPSVNLWHZKGE-SFHVURJKSA-N |
| XLogP | 5.05 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|