C41H50FN5O3Si — CID 163375793
N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-(2-ethyl-5-fluoro-4-phenylmethoxyphenyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375793) has the molecular formula C41H50FN5O3Si and a molecular weight of 707.97 g/mol. Its IUPAC name is N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-(2-ethyl-5-fluoro-4-phenylmethoxyphenyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-(2-ethyl-5-fluoro-4-phenylmethoxyphenyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375793 |
| Molecular Formula | C41H50FN5O3Si |
| Molecular Weight | 707.97 g/mol |
| Exact Mass | 707.37 |
| IUPAC Name | N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-(2-ethyl-5-fluoro-4-phenylmethoxyphenyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O[Si](C)(C)C(C)(C)C)ccc1/N=C(\N)c1cnn2cc(-c3cc(F)c(OCc4ccccc4)cc3CC)cc2c1N[C@H]1CCOC1 |
| InChI | InChI=1S/C41H50FN5O3Si/c1-8-28-21-38(49-25-27-13-11-10-12-14-27)35(42)22-33(28)30-20-37-39(45-31-17-18-48-26-31)34(23-44-47(37)24-30)40(43)46-36-16-15-32(19-29(36)9-2)50-51(6,7)41(3,4)5/h10-16,19-24,31,45H,8-9,17-18,25-26H2,1-7H3,(H2,43,46)/t31-/m0/s1 |
| InChIKey | ZSYPJSBAUIKICZ-HKBQPEDESA-N |
| XLogP | 9.47 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.97 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|