C32H46BrFN6O3Si — CID 163375852
tert-butyl N-[(1S,3R)-3-[[6-bromo-3-[N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclopentyl]carbamate (PubChem CID 163375852) has the molecular formula C32H46BrFN6O3Si and a molecular weight of 689.75 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-[[6-bromo-3-[N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-[[6-bromo-3-[N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 163375852 |
| Molecular Formula | C32H46BrFN6O3Si |
| Molecular Weight | 689.75 g/mol |
| Exact Mass | 688.26 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-[[6-bromo-3-[N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclopentyl]carbamate |
| SMILES | CCc1cc(O[Si](C)(C)C(C)(C)C)c(F)cc1/N=C(\N)c1cnn2cc(Br)cc2c1N[C@@H]1CC[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C32H46BrFN6O3Si/c1-10-19-13-27(43-44(8,9)32(5,6)7)24(34)16-25(19)39-29(35)23-17-36-40-18-20(33)14-26(40)28(23)37-21-11-12-22(15-21)38-30(41)42-31(2,3)4/h13-14,16-18,21-22,37H,10-12,15H2,1-9H3,(H2,35,39)(H,38,41)/t21-,22+/m1/s1 |
| InChIKey | JZDVGDWHGNXMOG-YADHBBJMSA-N |
| XLogP | 8.08 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.75 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|