C32H35FN6O3 — CID 163375881
N'-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[(5-hydroxy-2-adamantyl)amino]-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375881) has the molecular formula C32H35FN6O3 and a molecular weight of 570.67 g/mol. Its IUPAC name is N'-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[(5-hydroxy-2-adamantyl)amino]-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[(5-hydroxy-2-adamantyl)amino]-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375881 |
| Molecular Formula | C32H35FN6O3 |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | N'-(2-ethyl-5-fluoro-4-hydroxyphenyl)-4-[(5-hydroxy-2-adamantyl)amino]-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O)c(F)cc1/N=C(/N)c1cnn2cc(-c3ccc(OC)nc3)cc2c1NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C32H35FN6O3/c1-3-18-9-27(40)24(33)10-25(18)37-31(34)23-15-36-39-16-22(19-4-5-28(42-2)35-14-19)8-26(39)30(23)38-29-20-6-17-7-21(29)13-32(41,11-17)12-20/h4-5,8-10,14-17,20-21,29,38,40-41H,3,6-7,11-13H2,1-2H3,(H2,34,37) |
| InChIKey | YAIUGYHODHYPHR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|