C29H39BrF3N5OSi — CID 163375920
6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375920) has the molecular formula C29H39BrF3N5OSi and a molecular weight of 638.65 g/mol. Its IUPAC name is 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375920 |
| Molecular Formula | C29H39BrF3N5OSi |
| Molecular Weight | 638.65 g/mol |
| Exact Mass | 637.21 |
| IUPAC Name | 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O[Si](C)(C)C(C)(C)C)ccc1/N=C(/N)c1cnn2cc(Br)cc2c1NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C29H39BrF3N5OSi/c1-7-18-14-20(39-40(5,6)28(2,3)4)12-13-23(18)37-27(34)21-16-35-38-17-19(30)15-25(38)26(21)36-24-11-9-8-10-22(24)29(31,32)33/h12-17,22,24,36H,7-11H2,1-6H3,(H2,34,37) |
| InChIKey | HSEUASLAQRMVMH-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.65 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|