C30H44BrFN6OSi — CID 163376135
4-[[(1R)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163376135) has the molecular formula C30H44BrFN6OSi and a molecular weight of 631.71 g/mol. Its IUPAC name is 4-[[(1R)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 4-[[(1R)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163376135 |
| Molecular Formula | C30H44BrFN6OSi |
| Molecular Weight | 631.71 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 4-[[(1R)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O[Si](C)(C)C(C)(C)C)c(F)cc1/N=C(\N)c1cnn2cc(Br)cc2c1N[C@@H]1CCC(C)(N)C1(C)C |
| InChI | InChI=1S/C30H44BrFN6OSi/c1-10-18-13-24(39-40(8,9)28(2,3)4)21(32)15-22(18)36-27(33)20-16-35-38-17-19(31)14-23(38)26(20)37-25-11-12-30(7,34)29(25,5)6/h13-17,25,37H,10-12,34H2,1-9H3,(H2,33,36)/t25-,30?/m1/s1 |
| InChIKey | VHJADHCNFNVWAU-GOWJNXQMSA-N |
| XLogP | 7.54 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.71 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|