C25H36F3NO6 — CID 163376951
tert-butyl (2S)-2-[(4-ethoxycarbonyl-5,5,5-trifluoro-4-phenylmethoxypentoxy)methyl]pyrrolidine-1-carboxylate (PubChem CID 163376951) has the molecular formula C25H36F3NO6 and a molecular weight of 503.56 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-ethoxycarbonyl-5,5,5-trifluoro-4-phenylmethoxypentoxy)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(4-ethoxycarbonyl-5,5,5-trifluoro-4-phenylmethoxypentoxy)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163376951 |
| Molecular Formula | C25H36F3NO6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | tert-butyl (2S)-2-[(4-ethoxycarbonyl-5,5,5-trifluoro-4-phenylmethoxypentoxy)methyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C(CCCOC[C@@H]1CCCN1C(=O)OC(C)(C)C)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C25H36F3NO6/c1-5-33-21(30)24(25(26,27)28,34-17-19-11-7-6-8-12-19)14-10-16-32-18-20-13-9-15-29(20)22(31)35-23(2,3)4/h6-8,11-12,20H,5,9-10,13-18H2,1-4H3/t20-,24?/m0/s1 |
| InChIKey | CLSGTCCUNGDXAD-QHELBMECSA-N |
| XLogP | 5.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|