C22H28F3N5O3 — CID 163376978
(12R)-20-amino-18-(oxolan-3-yl)-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaen-6-ol (PubChem CID 163376978) has the molecular formula C22H28F3N5O3 and a molecular weight of 467.49 g/mol. Its IUPAC name is (12R)-20-amino-18-(oxolan-3-yl)-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaen-6-ol.
| Compound Name | (12R)-20-amino-18-(oxolan-3-yl)-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaen-6-ol |
|---|---|
| PubChem CID | 163376978 |
| Molecular Formula | C22H28F3N5O3 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | (12R)-20-amino-18-(oxolan-3-yl)-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaen-6-ol |
| SMILES | Nc1cc(C2CCOC2)c2nc1-c1nnc(o1)C(O)(C(F)(F)F)CCCCC[C@@H]1CCCN21 |
| InChI | InChI=1S/C22H28F3N5O3/c23-22(24,25)21(31)8-3-1-2-5-14-6-4-9-30(14)18-15(13-7-10-32-12-13)11-16(26)17(27-18)19-28-29-20(21)33-19/h11,13-14,31H,1-10,12,26H2/t13?,14-,21?/m1/s1 |
| InChIKey | VWZVXWBRSUJZPE-YZGUTLMUSA-N |
| XLogP | 3.90 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |