C28H27F6N5O4 — CID 163377005
(6R,9Z)-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)spiro[19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-12,1'-cyclohexane] (PubChem CID 163377005) has the molecular formula C28H27F6N5O4 and a molecular weight of 611.54 g/mol. Its IUPAC name is (6R,9Z)-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)spiro[19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-12,1'-cyclohexane].
| Compound Name | (6R,9Z)-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)spiro[19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-12,1'-cyclohexane] |
|---|---|
| PubChem CID | 163377005 |
| Molecular Formula | C28H27F6N5O4 |
| Molecular Weight | 611.54 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | (6R,9Z)-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)spiro[19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaene-12,1'-cyclohexane] |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c2nc1-c1nnc(o1)[C@@](OCc1ccccc1)(C(F)(F)F)CC/C=C/CC1(CCCCC1)N2 |
| InChI | InChI=1S/C28H27F6N5O4/c29-27(30,31)19-16-20(39(40)41)21-23-37-38-24(43-23)26(28(32,33)34,42-17-18-10-4-1-5-11-18)15-9-3-8-14-25(36-22(19)35-21)12-6-2-7-13-25/h1,3-5,8,10-11,16H,2,6-7,9,12-15,17H2,(H,35,36)/b8-3+/t26-/m1/s1 |
| InChIKey | XLJRQTJSWXEKAG-ZOOUZETPSA-N |
| XLogP | 7.89 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.54 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|