About (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine
(6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine (PubChem CID 163377010) has the molecular formula C12H20FN
and a molecular weight of 197.30 g/mol. Its IUPAC name is (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine.
Molecular Properties
| Compound Name | (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine |
| PubChem CID | 163377010 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine |
| SMILES | C=C(/C=C\C/C(F)=C\C)C(N)CCC |
| InChI | InChI=1S/C12H20FN/c1-4-7-12(14)10(3)8-6-9-11(13)5-2/h5-6,8,12H,3-4,7,9,14H2,1-2H3/b8-6-,11-5+ |
| InChIKey | DDWFBGLSFGTGKU-QHPKLMRPSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine?
The IUPAC name of (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine (CID 163377010) is (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine.
What is the SMILES notation for (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine?
The canonical SMILES for (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine is C=C(/C=C\C/C(F)=C\C)C(N)CCC.
What is the InChIKey of (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine?
The InChIKey is DDWFBGLSFGTGKU-QHPKLMRPSA-N. The full InChI is InChI=1S/C12H20FN/c1-4-7-12(14)10(3)8-6-9-11(13)5-2/h5-6,8,12H,3-4,7,9,14H2,1-2H3/b8-6-,11-5+.
What are the key properties of (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine?
(6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine has a molecular weight of 197.30 g/mol, XLogP of 3.49, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z,9E)-9-fluoro-5-methylideneundeca-6,9-dien-4-amine is sourced from PubChem (CID 163377010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).