C24H29F6N5O3 — CID 163377135
tert-butyl N-[(12R)-6,18-bis(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaen-20-yl]carbamate (PubChem CID 163377135) has the molecular formula C24H29F6N5O3 and a molecular weight of 549.52 g/mol. Its IUPAC name is tert-butyl N-[(12R)-6,18-bis(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaen-20-yl]carbamate.
| Compound Name | tert-butyl N-[(12R)-6,18-bis(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaen-20-yl]carbamate |
|---|---|
| PubChem CID | 163377135 |
| Molecular Formula | C24H29F6N5O3 |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | tert-butyl N-[(12R)-6,18-bis(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaen-20-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(F)(F)F)c2nc1-c1nnc(o1)C(C(F)(F)F)CCCCC[C@@H]1CCCN21 |
| InChI | InChI=1S/C24H29F6N5O3/c1-22(2,3)38-21(36)31-16-12-15(24(28,29)30)18-32-17(16)20-34-33-19(37-20)14(23(25,26)27)10-6-4-5-8-13-9-7-11-35(13)18/h12-14H,4-11H2,1-3H3,(H,31,36)/t13-,14?/m1/s1 |
| InChIKey | BKAVHQWFKICYEO-KWCCSABGSA-N |
| XLogP | 7.08 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |