C16H16F3N5O2 — CID 163377307
(9Z)-17-amino-13-methyl-15-(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-6-one (PubChem CID 163377307) has the molecular formula C16H16F3N5O2 and a molecular weight of 367.33 g/mol. Its IUPAC name is (9Z)-17-amino-13-methyl-15-(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-6-one.
| Compound Name | (9Z)-17-amino-13-methyl-15-(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-6-one |
|---|---|
| PubChem CID | 163377307 |
| Molecular Formula | C16H16F3N5O2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (9Z)-17-amino-13-methyl-15-(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-6-one |
| SMILES | CN1CC/C=C/CCC(=O)c2nnc(o2)-c2nc1c(C(F)(F)F)cc2N |
| InChI | InChI=1S/C16H16F3N5O2/c1-24-7-5-3-2-4-6-11(25)14-22-23-15(26-14)12-10(20)8-9(13(24)21-12)16(17,18)19/h2-3,8H,4-7,20H2,1H3/b3-2+ |
| InChIKey | YRLYSGQGORVWJZ-NSCUHMNNSA-N |
| XLogP | 3.09 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|