C25H25F6N5O4 — CID 163377311
10,10-dimethyl-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaene (PubChem CID 163377311) has the molecular formula C25H25F6N5O4 and a molecular weight of 573.49 g/mol. Its IUPAC name is 10,10-dimethyl-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaene.
| Compound Name | 10,10-dimethyl-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaene |
|---|---|
| PubChem CID | 163377311 |
| Molecular Formula | C25H25F6N5O4 |
| Molecular Weight | 573.49 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | 10,10-dimethyl-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,14(18),15-pentaene |
| SMILES | CC1(C)CCCC(OCc2ccccc2)(C(F)(F)F)c2nnc(o2)-c2nc(c(C(F)(F)F)cc2[N+](=O)[O-])NCC1 |
| InChI | InChI=1S/C25H25F6N5O4/c1-22(2)9-6-10-23(25(29,30)31,39-14-15-7-4-3-5-8-15)21-35-34-20(40-21)18-17(36(37)38)13-16(24(26,27)28)19(33-18)32-12-11-22/h3-5,7-8,13H,6,9-12,14H2,1-2H3,(H,32,33) |
| InChIKey | RKDWWPWDDKYOIK-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.49 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|