C15H10Cl2FN3O — CID 163377959
4,7-dichloro-1-(2,6-dimethylphenyl)-6-fluoropyrido[2,3-d]pyrimidin-2-one (PubChem CID 163377959) has the molecular formula C15H10Cl2FN3O and a molecular weight of 338.17 g/mol. Its IUPAC name is 4,7-dichloro-1-(2,6-dimethylphenyl)-6-fluoropyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4,7-dichloro-1-(2,6-dimethylphenyl)-6-fluoropyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 163377959 |
| Molecular Formula | C15H10Cl2FN3O |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 4,7-dichloro-1-(2,6-dimethylphenyl)-6-fluoropyrido[2,3-d]pyrimidin-2-one |
| SMILES | Cc1cccc(C)c1-n1c(=O)nc(Cl)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C15H10Cl2FN3O/c1-7-4-3-5-8(2)11(7)21-14-9(12(16)20-15(21)22)6-10(18)13(17)19-14/h3-6H,1-2H3 |
| InChIKey | XHAQICBNXODDGQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|