About phenazine-1,2,3-triol
phenazine-1,2,3-triol (PubChem CID 163378643) has the molecular formula C12H8N2O3
and a molecular weight of 228.21 g/mol. Its IUPAC name is phenazine-1,2,3-triol.
Molecular Properties
| Compound Name | phenazine-1,2,3-triol |
| PubChem CID | 163378643 |
| Molecular Formula | C12H8N2O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | phenazine-1,2,3-triol |
| SMILES | Oc1cc2nc3ccccc3nc2c(O)c1O |
| InChI | InChI=1S/C12H8N2O3/c15-9-5-8-10(12(17)11(9)16)14-7-4-2-1-3-6(7)13-8/h1-5,15-17H |
| InChIKey | VNGCXYJYHHHWLN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze phenazine-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenazine-1,2,3-triol?
The IUPAC name of phenazine-1,2,3-triol (CID 163378643) is phenazine-1,2,3-triol.
What is the SMILES notation for phenazine-1,2,3-triol?
The canonical SMILES for phenazine-1,2,3-triol is Oc1cc2nc3ccccc3nc2c(O)c1O.
What is the InChIKey of phenazine-1,2,3-triol?
The InChIKey is VNGCXYJYHHHWLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O3/c15-9-5-8-10(12(17)11(9)16)14-7-4-2-1-3-6(7)13-8/h1-5,15-17H.
What are the key properties of phenazine-1,2,3-triol?
phenazine-1,2,3-triol has a molecular weight of 228.21 g/mol, XLogP of 1.90, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenazine-1,2,3-triol is sourced from PubChem (CID 163378643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).