About 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde
2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde (PubChem CID 163378946) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde |
| PubChem CID | 163378946 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde |
| SMILES | NSC1C=C(C=O)C=CN1 |
| InChI | InChI=1S/C6H8N2OS/c7-10-6-3-5(4-9)1-2-8-6/h1-4,6,8H,7H2 |
| InChIKey | YGFYPBLVEVBEPK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde?
The IUPAC name of 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde (CID 163378946) is 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde.
What is the SMILES notation for 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde?
The canonical SMILES for 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde is NSC1C=C(C=O)C=CN1.
What is the InChIKey of 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde?
The InChIKey is YGFYPBLVEVBEPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c7-10-6-3-5(4-9)1-2-8-6/h1-4,6,8H,7H2.
What are the key properties of 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde?
2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde has a molecular weight of 156.21 g/mol, XLogP of 0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminosulfanyl-1,2-dihydropyridine-4-carbaldehyde is sourced from PubChem (CID 163378946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).