C21H21FN2O3 — CID 163379508
5-[(2-fluorophenyl)methoxy]-2-methyl-N-[(3S)-pyrrolidin-3-yl]-1-benzofuran-3-carboxamide (PubChem CID 163379508) has the molecular formula C21H21FN2O3 and a molecular weight of 368.41 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methoxy]-2-methyl-N-[(3S)-pyrrolidin-3-yl]-1-benzofuran-3-carboxamide.
| Compound Name | 5-[(2-fluorophenyl)methoxy]-2-methyl-N-[(3S)-pyrrolidin-3-yl]-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 163379508 |
| Molecular Formula | C21H21FN2O3 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 5-[(2-fluorophenyl)methoxy]-2-methyl-N-[(3S)-pyrrolidin-3-yl]-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2ccc(OCc3ccccc3F)cc2c1C(=O)N[C@H]1CCNC1 |
| InChI | InChI=1S/C21H21FN2O3/c1-13-20(21(25)24-15-8-9-23-11-15)17-10-16(6-7-19(17)27-13)26-12-14-4-2-3-5-18(14)22/h2-7,10,15,23H,8-9,11-12H2,1H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | VRHILIRFRUKBDC-HNNXBMFYSA-N |
| XLogP | 3.55 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |