C18H17NO5S — CID 163379631
2-methyl-N-methylsulfonyl-5-phenylmethoxy-1-benzofuran-3-carboxamide (PubChem CID 163379631) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is 2-methyl-N-methylsulfonyl-5-phenylmethoxy-1-benzofuran-3-carboxamide.
| Compound Name | 2-methyl-N-methylsulfonyl-5-phenylmethoxy-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 163379631 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-methyl-N-methylsulfonyl-5-phenylmethoxy-1-benzofuran-3-carboxamide |
| SMILES | Cc1oc2ccc(OCc3ccccc3)cc2c1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C18H17NO5S/c1-12-17(18(20)19-25(2,21)22)15-10-14(8-9-16(15)24-12)23-11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H,19,20) |
| InChIKey | KCSOAZBKFFFSEJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |