C10H16O3 — CID 163379852
2-methoxyethyl (1S)-4-methylcyclopent-2-ene-1-carboxylate (PubChem CID 163379852) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 2-methoxyethyl (1S)-4-methylcyclopent-2-ene-1-carboxylate.
| Compound Name | 2-methoxyethyl (1S)-4-methylcyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 163379852 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-methoxyethyl (1S)-4-methylcyclopent-2-ene-1-carboxylate |
| SMILES | COCCOC(=O)[C@@H]1C=CC(C)C1 |
| InChI | InChI=1S/C10H16O3/c1-8-3-4-9(7-8)10(11)13-6-5-12-2/h3-4,8-9H,5-7H2,1-2H3/t8?,9-/m1/s1 |
| InChIKey | LUENVHAOHVIQKM-YGPZHTELSA-N |
| XLogP | 1.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|