About 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine
3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine (PubChem CID 163380589) has the molecular formula C18H39F3N2
and a molecular weight of 340.52 g/mol. Its IUPAC name is 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine.
Molecular Properties
| Compound Name | 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine |
| PubChem CID | 163380589 |
| Molecular Formula | C18H39F3N2 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine |
| SMILES | CC.CC.CC1CNCC(F)(F)C1.CCCC1CNCCC1F |
| InChI | InChI=1S/C8H16FN.C6H11F2N.2C2H6/c1-2-3-7-6-10-5-4-8(7)9;1-5-2-6(7,8)4-9-3-5;2*1-2/h7-8,10H,2-6H2,1H3;5,9H,2-4H2,1H3;2*1-2H3 |
| InChIKey | LTVHFBLUFRPIGT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine?
The IUPAC name of 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine (CID 163380589) is 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine.
What is the SMILES notation for 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine?
The canonical SMILES for 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine is CC.CC.CC1CNCC(F)(F)C1.CCCC1CNCCC1F.
What is the InChIKey of 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine?
The InChIKey is LTVHFBLUFRPIGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FN.C6H11F2N.2C2H6/c1-2-3-7-6-10-5-4-8(7)9;1-5-2-6(7,8)4-9-3-5;2*1-2/h7-8,10H,2-6H2,1H3;5,9H,2-4H2,1H3;2*1-2H3.
What are the key properties of 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine?
3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine has a molecular weight of 340.52 g/mol, XLogP of 5.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-5-methylpiperidine;ethane;4-fluoro-3-propylpiperidine is sourced from PubChem (CID 163380589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).