About 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole
4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole (PubChem CID 163381202) has the molecular formula C12H11N3S
and a molecular weight of 229.31 g/mol. Its IUPAC name is 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole |
| PubChem CID | 163381202 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole |
| SMILES | Cc1n[nH]c(C)c1-c1cccc2scnc12 |
| InChI | InChI=1S/C12H11N3S/c1-7-11(8(2)15-14-7)9-4-3-5-10-12(9)13-6-16-10/h3-6H,1-2H3,(H,14,15) |
| InChIKey | YFMRWZLTMDNCMD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole?
The IUPAC name of 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole (CID 163381202) is 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole.
What is the SMILES notation for 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole?
The canonical SMILES for 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole is Cc1n[nH]c(C)c1-c1cccc2scnc12.
What is the InChIKey of 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole?
The InChIKey is YFMRWZLTMDNCMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3S/c1-7-11(8(2)15-14-7)9-4-3-5-10-12(9)13-6-16-10/h3-6H,1-2H3,(H,14,15).
What are the key properties of 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole?
4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole has a molecular weight of 229.31 g/mol, XLogP of 3.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethyl-1H-pyrazol-4-yl)-1,3-benzothiazole is sourced from PubChem (CID 163381202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).