About 4-bromo-1,3-benzothiazole-7-carboxamide
4-bromo-1,3-benzothiazole-7-carboxamide (PubChem CID 163381215) has the molecular formula C8H5BrN2OS
and a molecular weight of 257.11 g/mol. Its IUPAC name is 4-bromo-1,3-benzothiazole-7-carboxamide.
Molecular Properties
| Compound Name | 4-bromo-1,3-benzothiazole-7-carboxamide |
| PubChem CID | 163381215 |
| Molecular Formula | C8H5BrN2OS |
| Molecular Weight | 257.11 g/mol |
| Exact Mass | 255.93 |
| IUPAC Name | 4-bromo-1,3-benzothiazole-7-carboxamide |
| SMILES | NC(=O)c1ccc(Br)c2ncsc12 |
| InChI | InChI=1S/C8H5BrN2OS/c9-5-2-1-4(8(10)12)7-6(5)11-3-13-7/h1-3H,(H2,10,12) |
| InChIKey | VRGUMGKTOCZAIT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.11 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-1,3-benzothiazole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,3-benzothiazole-7-carboxamide?
The IUPAC name of 4-bromo-1,3-benzothiazole-7-carboxamide (CID 163381215) is 4-bromo-1,3-benzothiazole-7-carboxamide.
What is the SMILES notation for 4-bromo-1,3-benzothiazole-7-carboxamide?
The canonical SMILES for 4-bromo-1,3-benzothiazole-7-carboxamide is NC(=O)c1ccc(Br)c2ncsc12.
What is the InChIKey of 4-bromo-1,3-benzothiazole-7-carboxamide?
The InChIKey is VRGUMGKTOCZAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2OS/c9-5-2-1-4(8(10)12)7-6(5)11-3-13-7/h1-3H,(H2,10,12).
What are the key properties of 4-bromo-1,3-benzothiazole-7-carboxamide?
4-bromo-1,3-benzothiazole-7-carboxamide has a molecular weight of 257.11 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,3-benzothiazole-7-carboxamide is sourced from PubChem (CID 163381215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).