C23H23F2NO2 — CID 163382484
2-[(1S)-1-cyclopropyl-2-hydroxy-2-methylpropyl]-7-[(E)-2-(2,4-difluorophenyl)ethenyl]-3H-isoindol-1-one (PubChem CID 163382484) has the molecular formula C23H23F2NO2 and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-[(1S)-1-cyclopropyl-2-hydroxy-2-methylpropyl]-7-[(E)-2-(2,4-difluorophenyl)ethenyl]-3H-isoindol-1-one.
| Compound Name | 2-[(1S)-1-cyclopropyl-2-hydroxy-2-methylpropyl]-7-[(E)-2-(2,4-difluorophenyl)ethenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 163382484 |
| Molecular Formula | C23H23F2NO2 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[(1S)-1-cyclopropyl-2-hydroxy-2-methylpropyl]-7-[(E)-2-(2,4-difluorophenyl)ethenyl]-3H-isoindol-1-one |
| SMILES | CC(C)(O)[C@H](C1CC1)N1Cc2cccc(/C=C/c3ccc(F)cc3F)c2C1=O |
| InChI | InChI=1S/C23H23F2NO2/c1-23(2,28)21(16-8-9-16)26-13-17-5-3-4-15(20(17)22(26)27)7-6-14-10-11-18(24)12-19(14)25/h3-7,10-12,16,21,28H,8-9,13H2,1-2H3/b7-6+/t21-/m0/s1 |
| InChIKey | IWZOKFWUPVJZKL-BXKJMJEDSA-N |
| XLogP | 4.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|