C10H13F2N3O — CID 163383247
N-[[6-(difluoromethoxy)pyridazin-3-yl]methyl]cyclobutanamine (PubChem CID 163383247) has the molecular formula C10H13F2N3O and a molecular weight of 229.23 g/mol. Its IUPAC name is N-[[6-(difluoromethoxy)pyridazin-3-yl]methyl]cyclobutanamine.
| Compound Name | N-[[6-(difluoromethoxy)pyridazin-3-yl]methyl]cyclobutanamine |
|---|---|
| PubChem CID | 163383247 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-[[6-(difluoromethoxy)pyridazin-3-yl]methyl]cyclobutanamine |
| SMILES | FC(F)Oc1ccc(CNC2CCC2)nn1 |
| InChI | InChI=1S/C10H13F2N3O/c11-10(12)16-9-5-4-8(14-15-9)6-13-7-2-1-3-7/h4-5,7,10,13H,1-3,6H2 |
| InChIKey | IESBQPXTWUEPGA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |