C21H31NO — CID 163383722
(1R,2S,5S,9R,12S,13S,18S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-6-en-16-one (PubChem CID 163383722) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is (1R,2S,5S,9R,12S,13S,18S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-6-en-16-one.
| Compound Name | (1R,2S,5S,9R,12S,13S,18S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-6-en-16-one |
|---|---|
| PubChem CID | 163383722 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (1R,2S,5S,9R,12S,13S,18S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-6-en-16-one |
| SMILES | CC1=NC[C@]23CC[C@H]4[C@@H](CC[C@H]5CC(=O)CC[C@@]54C)[C@@H]2CC[C@H]13 |
| InChI | InChI=1S/C21H31NO/c1-13-17-5-6-19-16-4-3-14-11-15(23)7-9-20(14,2)18(16)8-10-21(17,19)12-22-13/h14,16-19H,3-12H2,1-2H3/t14-,16+,17+,18-,19-,20-,21-/m0/s1 |
| InChIKey | RKXHGTYXSCZVLX-DYPMRMAUSA-N |
| XLogP | 4.67 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |