About (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane
(3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane (PubChem CID 163383977) has the molecular formula C15H24F2N2O2
and a molecular weight of 302.37 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane.
Molecular Properties
| Compound Name | (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane |
| PubChem CID | 163383977 |
| Molecular Formula | C15H24F2N2O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane |
| SMILES | CC.OC(c1cnn(C2CCCCO2)c1)C1CC(F)(F)C1 |
| InChI | InChI=1S/C13H18F2N2O2.C2H6/c14-13(15)5-9(6-13)12(18)10-7-16-17(8-10)11-3-1-2-4-19-11;1-2/h7-9,11-12,18H,1-6H2;1-2H3 |
| InChIKey | BMNUVGOEJNBLPF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane?
The IUPAC name of (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane (CID 163383977) is (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane.
What is the SMILES notation for (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane?
The canonical SMILES for (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane is CC.OC(c1cnn(C2CCCCO2)c1)C1CC(F)(F)C1.
What is the InChIKey of (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane?
The InChIKey is BMNUVGOEJNBLPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2N2O2.C2H6/c14-13(15)5-9(6-13)12(18)10-7-16-17(8-10)11-3-1-2-4-19-11;1-2/h7-9,11-12,18H,1-6H2;1-2H3.
What are the key properties of (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane?
(3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane has a molecular weight of 302.37 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluorocyclobutyl)-[1-(oxan-2-yl)pyrazol-4-yl]methanol;ethane is sourced from PubChem (CID 163383977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).