C34H29BrF3N7O2 — CID 163383997
(11S)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-ethyl-7-[3-(methylamino)-1H-indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 163383997) has the molecular formula C34H29BrF3N7O2 and a molecular weight of 704.55 g/mol. Its IUPAC name is (11S)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-ethyl-7-[3-(methylamino)-1H-indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | (11S)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-ethyl-7-[3-(methylamino)-1H-indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 163383997 |
| Molecular Formula | C34H29BrF3N7O2 |
| Molecular Weight | 704.55 g/mol |
| Exact Mass | 703.15 |
| IUPAC Name | (11S)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-ethyl-7-[3-(methylamino)-1H-indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | CC[C@H]1Cc2c(n3ncc(Cc4ccccc4)c3n(-c3ccc4c(NC)n[nH]c4c3)c2=O)CN1C(=O)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H29BrF3N7O2/c1-3-22-15-25-29(18-43(22)32(46)20-9-12-27(35)26(14-20)34(36,37)38)45-31(21(17-40-45)13-19-7-5-4-6-8-19)44(33(25)47)23-10-11-24-28(16-23)41-42-30(24)39-2/h4-12,14,16-17,22H,3,13,15,18H2,1-2H3,(H2,39,41,42)/t22-/m0/s1 |
| InChIKey | DTAWYHLOEJZPSX-QFIPXVFZSA-N |
| XLogP | 6.75 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.55 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |