C33H27BrF3N7O2 — CID 163384055
(11R)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-methyl-7-[3-(methylamino)-1H-indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 163384055) has the molecular formula C33H27BrF3N7O2 and a molecular weight of 690.52 g/mol. Its IUPAC name is (11R)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-methyl-7-[3-(methylamino)-1H-indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | (11R)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-methyl-7-[3-(methylamino)-1H-indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 163384055 |
| Molecular Formula | C33H27BrF3N7O2 |
| Molecular Weight | 690.52 g/mol |
| Exact Mass | 689.14 |
| IUPAC Name | (11R)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-methyl-7-[3-(methylamino)-1H-indazol-6-yl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | CNc1n[nH]c2cc(-n3c(=O)c4c(n5ncc(Cc6ccccc6)c35)CN(C(=O)c3ccc(Br)c(C(F)(F)F)c3)[C@H](C)C4)ccc12 |
| InChI | InChI=1S/C33H27BrF3N7O2/c1-18-12-24-28(17-42(18)31(45)20-8-11-26(34)25(14-20)33(35,36)37)44-30(21(16-39-44)13-19-6-4-3-5-7-19)43(32(24)46)22-9-10-23-27(15-22)40-41-29(23)38-2/h3-11,14-16,18H,12-13,17H2,1-2H3,(H2,38,40,41)/t18-/m1/s1 |
| InChIKey | KQCLJBFQTBPRCO-GOSISDBHSA-N |
| XLogP | 6.36 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |