C32H24BrF3N8O2 — CID 163384079
(11R)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-methyl-7-[4-(2H-tetrazol-5-yl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 163384079) has the molecular formula C32H24BrF3N8O2 and a molecular weight of 689.50 g/mol. Its IUPAC name is (11R)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-methyl-7-[4-(2H-tetrazol-5-yl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | (11R)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-methyl-7-[4-(2H-tetrazol-5-yl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 163384079 |
| Molecular Formula | C32H24BrF3N8O2 |
| Molecular Weight | 689.50 g/mol |
| Exact Mass | 688.12 |
| IUPAC Name | (11R)-5-benzyl-12-[4-bromo-3-(trifluoromethyl)benzoyl]-11-methyl-7-[4-(2H-tetrazol-5-yl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | C[C@@H]1Cc2c(n3ncc(Cc4ccccc4)c3n(-c3ccc(-c4nn[nH]n4)cc3)c2=O)CN1C(=O)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H24BrF3N8O2/c1-18-13-24-27(17-42(18)30(45)21-9-12-26(33)25(15-21)32(34,35)36)44-29(22(16-37-44)14-19-5-3-2-4-6-19)43(31(24)46)23-10-7-20(8-11-23)28-38-40-41-39-28/h2-12,15-16,18H,13-14,17H2,1H3,(H,38,39,40,41)/t18-/m1/s1 |
| InChIKey | KNGKOWHXWAGTKK-GOSISDBHSA-N |
| XLogP | 5.62 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |