C16H29BN2O2 — CID 163384455
1-[2-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3-propan-2-ylpyrazole (PubChem CID 163384455) has the molecular formula C16H29BN2O2 and a molecular weight of 292.23 g/mol. Its IUPAC name is 1-[2-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3-propan-2-ylpyrazole.
| Compound Name | 1-[2-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3-propan-2-ylpyrazole |
|---|---|
| PubChem CID | 163384455 |
| Molecular Formula | C16H29BN2O2 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 1-[2-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-3-propan-2-ylpyrazole |
| SMILES | CC(C)c1ccn(CC(C)(C)B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C16H29BN2O2/c1-12(2)13-9-10-19(18-13)11-14(3,4)17-20-15(5,6)16(7,8)21-17/h9-10,12H,11H2,1-8H3 |
| InChIKey | BNTJWFLFIDWRMQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|