About ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine
ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine (PubChem CID 163384575) has the molecular formula C9H23NOS2
and a molecular weight of 225.42 g/mol. Its IUPAC name is ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine |
| PubChem CID | 163384575 |
| Molecular Formula | C9H23NOS2 |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine |
| SMILES | CC.CC.CCSC/C(CS)=N\O |
| InChI | InChI=1S/C5H11NOS2.2C2H6/c1-2-9-4-5(3-8)6-7;2*1-2/h7-8H,2-4H2,1H3;2*1-2H3/b6-5-;; |
| InChIKey | VYXUOSIJODYTMS-XNOMRPDFSA-N |
| XLogP | 3.55 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine?
The IUPAC name of ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine (CID 163384575) is ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine.
What is the SMILES notation for ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine?
The canonical SMILES for ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine is CC.CC.CCSC/C(CS)=N\O.
What is the InChIKey of ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine?
The InChIKey is VYXUOSIJODYTMS-XNOMRPDFSA-N. The full InChI is InChI=1S/C5H11NOS2.2C2H6/c1-2-9-4-5(3-8)6-7;2*1-2/h7-8H,2-4H2,1H3;2*1-2H3/b6-5-;;.
What are the key properties of ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine?
ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine has a molecular weight of 225.42 g/mol, XLogP of 3.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(NZ)-N-(1-ethylsulfanyl-3-sulfanylpropan-2-ylidene)hydroxylamine is sourced from PubChem (CID 163384575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).