About (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane
(E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane (PubChem CID 163385158) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane.
Molecular Properties
| Compound Name | (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane |
| PubChem CID | 163385158 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane |
| SMILES | C/C(C=O)=C(/C)C(=O)NC(C)C.COC(C)C |
| InChI | InChI=1S/C9H15NO2.C4H10O/c1-6(2)10-9(12)8(4)7(3)5-11;1-4(2)5-3/h5-6H,1-4H3,(H,10,12);4H,1-3H3/b8-7+; |
| InChIKey | DCYCZDFMYLTXQP-USRGLUTNSA-N |
| XLogP | 2.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane?
The IUPAC name of (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane (CID 163385158) is (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane.
What is the SMILES notation for (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane?
The canonical SMILES for (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane is C/C(C=O)=C(/C)C(=O)NC(C)C.COC(C)C.
What is the InChIKey of (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane?
The InChIKey is DCYCZDFMYLTXQP-USRGLUTNSA-N. The full InChI is InChI=1S/C9H15NO2.C4H10O/c1-6(2)10-9(12)8(4)7(3)5-11;1-4(2)5-3/h5-6H,1-4H3,(H,10,12);4H,1-3H3/b8-7+;.
What are the key properties of (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane?
(E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane has a molecular weight of 243.35 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-dimethyl-4-oxo-N-propan-2-ylbut-2-enamide;2-methoxypropane is sourced from PubChem (CID 163385158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).