C21H19ClFN5O — CID 163385517
[4-[(6-chloro-3-pyridinyl)methyl]-4-fluoropiperidin-1-yl]-(2-pyrimidin-4-yl-3-pyridinyl)methanone (PubChem CID 163385517) has the molecular formula C21H19ClFN5O and a molecular weight of 411.87 g/mol. Its IUPAC name is [4-[(6-chloro-3-pyridinyl)methyl]-4-fluoropiperidin-1-yl]-(2-pyrimidin-4-yl-3-pyridinyl)methanone.
| Compound Name | [4-[(6-chloro-3-pyridinyl)methyl]-4-fluoropiperidin-1-yl]-(2-pyrimidin-4-yl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 163385517 |
| Molecular Formula | C21H19ClFN5O |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [4-[(6-chloro-3-pyridinyl)methyl]-4-fluoropiperidin-1-yl]-(2-pyrimidin-4-yl-3-pyridinyl)methanone |
| SMILES | O=C(c1cccnc1-c1ccncn1)N1CCC(F)(Cc2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C21H19ClFN5O/c22-18-4-3-15(13-26-18)12-21(23)6-10-28(11-7-21)20(29)16-2-1-8-25-19(16)17-5-9-24-14-27-17/h1-5,8-9,13-14H,6-7,10-12H2 |
| InChIKey | OWAOTHDLEJBSGB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|