About N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide
N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide (PubChem CID 163385818) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide.
Molecular Properties
| Compound Name | N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide |
| PubChem CID | 163385818 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide |
| SMILES | C=CN(CC)/C(C=C(C)C)=N/C |
| InChI | InChI=1S/C10H18N2/c1-6-12(7-2)10(11-5)8-9(3)4/h6,8H,1,7H2,2-5H3/b11-10+ |
| InChIKey | GXUYKWNLTIOEFC-ZHACJKMWSA-N |
| XLogP | 2.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide?
The IUPAC name of N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide (CID 163385818) is N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide.
What is the SMILES notation for N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide?
The canonical SMILES for N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide is C=CN(CC)/C(C=C(C)C)=N/C.
What is the InChIKey of N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide?
The InChIKey is GXUYKWNLTIOEFC-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H18N2/c1-6-12(7-2)10(11-5)8-9(3)4/h6,8H,1,7H2,2-5H3/b11-10+.
What are the key properties of N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide?
N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide has a molecular weight of 166.27 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N-ethyl-N',3-dimethylbut-2-enimidamide is sourced from PubChem (CID 163385818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).