About N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide
N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide (PubChem CID 163386517) has the molecular formula C14H17NO2
and a molecular weight of 231.29 g/mol. Its IUPAC name is N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide.
Molecular Properties
| Compound Name | N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide |
| PubChem CID | 163386517 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide |
| SMILES | C=Cc1cc(C(C)NC=O)cc(OC)c1C=C |
| InChI | InChI=1S/C14H17NO2/c1-5-11-7-12(10(3)15-9-16)8-14(17-4)13(11)6-2/h5-10H,1-2H2,3-4H3,(H,15,16) |
| InChIKey | NOKZBWMMRUDYOA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide?
The IUPAC name of N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide (CID 163386517) is N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide.
What is the SMILES notation for N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide?
The canonical SMILES for N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide is C=Cc1cc(C(C)NC=O)cc(OC)c1C=C.
What is the InChIKey of N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide?
The InChIKey is NOKZBWMMRUDYOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c1-5-11-7-12(10(3)15-9-16)8-14(17-4)13(11)6-2/h5-10H,1-2H2,3-4H3,(H,15,16).
What are the key properties of N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide?
N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide has a molecular weight of 231.29 g/mol, XLogP of 2.79, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[3,4-bis(ethenyl)-5-methoxyphenyl]ethyl]formamide is sourced from PubChem (CID 163386517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).