About 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline
4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline (PubChem CID 163386657) has the molecular formula C17H23FN4
and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline.
Molecular Properties
| Compound Name | 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline |
| PubChem CID | 163386657 |
| Molecular Formula | C17H23FN4 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline |
| SMILES | C=C(C)[C@@H](n1cc(CNc2ccc(F)cc2)nn1)C(C)(C)C |
| InChI | InChI=1S/C17H23FN4/c1-12(2)16(17(3,4)5)22-11-15(20-21-22)10-19-14-8-6-13(18)7-9-14/h6-9,11,16,19H,1,10H2,2-5H3/t16-/m1/s1 |
| InChIKey | LKNHAHXKHJSSPU-MRXNPFEDSA-N |
| XLogP | 4.19 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline?
The IUPAC name of 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline (CID 163386657) is 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline.
What is the SMILES notation for 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline?
The canonical SMILES for 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline is C=C(C)[C@@H](n1cc(CNc2ccc(F)cc2)nn1)C(C)(C)C.
What is the InChIKey of 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline?
The InChIKey is LKNHAHXKHJSSPU-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H23FN4/c1-12(2)16(17(3,4)5)22-11-15(20-21-22)10-19-14-8-6-13(18)7-9-14/h6-9,11,16,19H,1,10H2,2-5H3/t16-/m1/s1.
What are the key properties of 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline?
4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline has a molecular weight of 302.40 g/mol, XLogP of 4.19, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-[[1-[(3S)-2,4,4-trimethylpent-1-en-3-yl]triazol-4-yl]methyl]aniline is sourced from PubChem (CID 163386657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).