C24H26ClFN6O6 — CID 163387872
tert-butyl 7-chloro-10-[[(2R)-1-[(3-fluoro-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate (PubChem CID 163387872) has the molecular formula C24H26ClFN6O6 and a molecular weight of 548.96 g/mol. Its IUPAC name is tert-butyl 7-chloro-10-[[(2R)-1-[(3-fluoro-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate.
| Compound Name | tert-butyl 7-chloro-10-[[(2R)-1-[(3-fluoro-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 163387872 |
| Molecular Formula | C24H26ClFN6O6 |
| Molecular Weight | 548.96 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | tert-butyl 7-chloro-10-[[(2R)-1-[(3-fluoro-5-nitrophenyl)methoxy]propan-2-yl]carbamoyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate |
| SMILES | C[C@H](COCc1cc(F)cc([N+](=O)[O-])c1)NC(=O)c1cnn2c3c(c(Cl)nc12)CCN3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H26ClFN6O6/c1-13(11-37-12-14-7-15(26)9-16(8-14)32(35)36)28-21(33)18-10-27-31-20(18)29-19(25)17-5-6-30(22(17)31)23(34)38-24(2,3)4/h7-10,13H,5-6,11-12H2,1-4H3,(H,28,33)/t13-/m1/s1 |
| InChIKey | OJJBUKIYLRUBBM-CYBMUJFWSA-N |
| XLogP | 4.06 |
| TPSA | 141.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.96 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|