C24H28ClFN6O4 — CID 163387875
tert-butyl 10-[[(2R)-1-[(3-amino-5-fluorophenyl)methoxy]propan-2-yl]carbamoyl]-7-chloro-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate (PubChem CID 163387875) has the molecular formula C24H28ClFN6O4 and a molecular weight of 518.98 g/mol. Its IUPAC name is tert-butyl 10-[[(2R)-1-[(3-amino-5-fluorophenyl)methoxy]propan-2-yl]carbamoyl]-7-chloro-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate.
| Compound Name | tert-butyl 10-[[(2R)-1-[(3-amino-5-fluorophenyl)methoxy]propan-2-yl]carbamoyl]-7-chloro-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 163387875 |
| Molecular Formula | C24H28ClFN6O4 |
| Molecular Weight | 518.98 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | tert-butyl 10-[[(2R)-1-[(3-amino-5-fluorophenyl)methoxy]propan-2-yl]carbamoyl]-7-chloro-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-3-carboxylate |
| SMILES | C[C@H](COCc1cc(N)cc(F)c1)NC(=O)c1cnn2c3c(c(Cl)nc12)CCN3C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H28ClFN6O4/c1-13(11-35-12-14-7-15(26)9-16(27)8-14)29-21(33)18-10-28-32-20(18)30-19(25)17-5-6-31(22(17)32)23(34)36-24(2,3)4/h7-10,13H,5-6,11-12,27H2,1-4H3,(H,29,33)/t13-/m1/s1 |
| InChIKey | CUNKWXGQJBIBJC-CYBMUJFWSA-N |
| XLogP | 3.74 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.98 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|