About methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate
methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate (PubChem CID 163388044) has the molecular formula C22H18Cl2N2O5
and a molecular weight of 461.30 g/mol. Its IUPAC name is methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate |
| PubChem CID | 163388044 |
| Molecular Formula | C22H18Cl2N2O5 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate |
| SMILES | CCn1c(C)c(-c2ccc([N+](=O)[O-])cc2)c(=O)c(C(=O)OC)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N2O5/c1-4-25-12(2)18(13-5-8-15(9-6-13)26(29)30)21(27)19(22(28)31-3)20(25)14-7-10-16(23)17(24)11-14/h5-11H,4H2,1-3H3 |
| InChIKey | DJVACQNNUOKEON-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate?
The IUPAC name of methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate (CID 163388044) is methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate.
What is the SMILES notation for methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate?
The canonical SMILES for methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate is CCn1c(C)c(-c2ccc([N+](=O)[O-])cc2)c(=O)c(C(=O)OC)c1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate?
The InChIKey is DJVACQNNUOKEON-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl2N2O5/c1-4-25-12(2)18(13-5-8-15(9-6-13)26(29)30)21(27)19(22(28)31-3)20(25)14-7-10-16(23)17(24)11-14/h5-11H,4H2,1-3H3.
What are the key properties of methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate?
methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate has a molecular weight of 461.30 g/mol, XLogP of 5.51, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylate is sourced from PubChem (CID 163388044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).